C28H20AsF9O2S — CID 171039438
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate;tetraphenylarsanium (PubChem CID 171039438) has the molecular formula C28H20AsF9O2S and a molecular weight of 666.44 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate;tetraphenylarsanium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate;tetraphenylarsanium |
|---|---|
| PubChem CID | 171039438 |
| Molecular Formula | C28H20AsF9O2S |
| Molecular Weight | 666.44 g/mol |
| Exact Mass | 666.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate;tetraphenylarsanium |
| SMILES | O=S([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc([As+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20As.C4HF9O2S/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;5-1(6,3(9,10)11)2(7,8)4(12,13)16(14)15/h1-20H;(H,14,15)/q+1;/p-1 |
| InChIKey | JVMIVRONIVOWMP-UHFFFAOYSA-M |
| XLogP | 5.36 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|