C10H5F9O3S-2 — CID 154509780
1,1,2,2,3,3,4,4,4-nonafluorobutyl-dioxido-oxo-phenyl-λ6-sulfane (PubChem CID 154509780) has the molecular formula C10H5F9O3S-2 and a molecular weight of 376.20 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutyl-dioxido-oxo-phenyl-λ6-sulfane.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl-dioxido-oxo-phenyl-λ6-sulfane |
|---|---|
| PubChem CID | 154509780 |
| Molecular Formula | C10H5F9O3S-2 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl-dioxido-oxo-phenyl-λ6-sulfane |
| SMILES | O=S([O-])([O-])(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F9O3S/c11-7(12,9(15,16)17)8(13,14)10(18,19)23(20,21,22)6-4-2-1-3-5-6/h1-5H,(H2,20,21,22)/p-2 |
| InChIKey | ZZLITFHCKMENEO-UHFFFAOYSA-L |
| XLogP | 3.55 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|