C22H15F9S — CID 175593186
1,1,2,2,3,3,4,4,4-nonafluorobutyl(triphenyl)-λ4-sulfane (PubChem CID 175593186) has the molecular formula C22H15F9S and a molecular weight of 482.41 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutyl(triphenyl)-λ4-sulfane.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl(triphenyl)-λ4-sulfane |
|---|---|
| PubChem CID | 175593186 |
| Molecular Formula | C22H15F9S |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl(triphenyl)-λ4-sulfane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)S(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H15F9S/c23-19(24,21(27,28)29)20(25,26)22(30,31)32(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | NEOLZJBDTJMRED-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|