C12H8F11NNaO5S2 — CID 57352622
CID 57352622 (PubChem CID 57352622) has the molecular formula C12H8F11NNaO5S2 and a molecular weight of 542.30 g/mol.
| Compound Name | CID 57352622 |
|---|---|
| PubChem CID | 57352622 |
| Molecular Formula | C12H8F11NNaO5S2 |
| Molecular Weight | 542.30 g/mol |
| Exact Mass | 541.96 |
| IUPAC Name | — |
| SMILES | O=S(=O)(OCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1.[Na] |
| InChI | InChI=1S/C12H8F11NO5S2.Na/c13-8(14,9(15,16)11(19,20)21)10(17,18)12(22,23)31(27,28)24-6-29-30(25,26)7-4-2-1-3-5-7;/h1-5,24H,6H2; |
| InChIKey | RIUJEZUNLBVGRA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|