C16H14F9NO2S — CID 101344890
1,1,2,2,3,3,4,4,4-nonafluoro-N-[(3E,5E)-6-phenylhexa-3,5-dienyl]butane-1-sulfonamide (PubChem CID 101344890) has the molecular formula C16H14F9NO2S and a molecular weight of 455.34 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-[(3E,5E)-6-phenylhexa-3,5-dienyl]butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-[(3E,5E)-6-phenylhexa-3,5-dienyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 101344890 |
| Molecular Formula | C16H14F9NO2S |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-[(3E,5E)-6-phenylhexa-3,5-dienyl]butane-1-sulfonamide |
| SMILES | O=S(=O)(NCC/C=C/C=C/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H14F9NO2S/c17-13(18,15(21,22)23)14(19,20)16(24,25)29(27,28)26-11-7-2-1-4-8-12-9-5-3-6-10-12/h1-6,8-10,26H,7,11H2/b2-1+,8-4+ |
| InChIKey | YJRDORMKFKWYJX-AIWOWGKTSA-N |
| XLogP | 4.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|