C9H7BrF4O3S — CID 155012618
(3-bromo-2,2,3,3-tetrafluoropropyl) benzenesulfonate (PubChem CID 155012618) has the molecular formula C9H7BrF4O3S and a molecular weight of 351.12 g/mol. Its IUPAC name is (3-bromo-2,2,3,3-tetrafluoropropyl) benzenesulfonate.
| Compound Name | (3-bromo-2,2,3,3-tetrafluoropropyl) benzenesulfonate |
|---|---|
| PubChem CID | 155012618 |
| Molecular Formula | C9H7BrF4O3S |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 349.92 |
| IUPAC Name | (3-bromo-2,2,3,3-tetrafluoropropyl) benzenesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)C(F)(F)Br)c1ccccc1 |
| InChI | InChI=1S/C9H7BrF4O3S/c10-9(13,14)8(11,12)6-17-18(15,16)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | NJHCDDWQALAGDM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|