C31H30O11S4 — CID 89088812
[4-(benzenesulfonyl)-2,2-bis(benzenesulfonyloxymethyl)pent-4-enyl] benzenesulfonate (PubChem CID 89088812) has the molecular formula C31H30O11S4 and a molecular weight of 706.84 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-2,2-bis(benzenesulfonyloxymethyl)pent-4-enyl] benzenesulfonate.
| Compound Name | [4-(benzenesulfonyl)-2,2-bis(benzenesulfonyloxymethyl)pent-4-enyl] benzenesulfonate |
|---|---|
| PubChem CID | 89088812 |
| Molecular Formula | C31H30O11S4 |
| Molecular Weight | 706.84 g/mol |
| Exact Mass | 706.07 |
| IUPAC Name | [4-(benzenesulfonyl)-2,2-bis(benzenesulfonyloxymethyl)pent-4-enyl] benzenesulfonate |
| SMILES | C=C(CC(COS(=O)(=O)c1ccccc1)(COS(=O)(=O)c1ccccc1)COS(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H30O11S4/c1-26(43(32,33)27-14-6-2-7-15-27)22-31(23-40-44(34,35)28-16-8-3-9-17-28,24-41-45(36,37)29-18-10-4-11-19-29)25-42-46(38,39)30-20-12-5-13-21-30/h2-21H,1,22-25H2 |
| InChIKey | HICAOYOAIFVYGQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|