C24H24O8S2 — CID 10767849
dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[2-(benzenesulfonyl)prop-2-enyl]propanedioate (PubChem CID 10767849) has the molecular formula C24H24O8S2 and a molecular weight of 504.58 g/mol. Its IUPAC name is dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[2-(benzenesulfonyl)prop-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[2-(benzenesulfonyl)prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 10767849 |
| Molecular Formula | C24H24O8S2 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[2-(benzenesulfonyl)prop-2-enyl]propanedioate |
| SMILES | C=C=C(CC(CC(=C)S(=O)(=O)c1ccccc1)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24O8S2/c1-5-19(34(29,30)21-14-10-7-11-15-21)17-24(22(25)31-3,23(26)32-4)16-18(2)33(27,28)20-12-8-6-9-13-20/h6-15H,1-2,16-17H2,3-4H3 |
| InChIKey | AMSQYTJCIRZZMT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|