C13H15IO2S — CID 15751078
7-iodohepta-1,2-dien-3-ylsulfonylbenzene (PubChem CID 15751078) has the molecular formula C13H15IO2S and a molecular weight of 362.23 g/mol. Its IUPAC name is 7-iodohepta-1,2-dien-3-ylsulfonylbenzene.
| Compound Name | 7-iodohepta-1,2-dien-3-ylsulfonylbenzene |
|---|---|
| PubChem CID | 15751078 |
| Molecular Formula | C13H15IO2S |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 7-iodohepta-1,2-dien-3-ylsulfonylbenzene |
| SMILES | C=C=C(CCCCI)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15IO2S/c1-2-12(8-6-7-11-14)17(15,16)13-9-4-3-5-10-13/h3-5,9-10H,1,6-8,11H2 |
| InChIKey | PDTCAHJVMIANMK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|