C14H14O3S — CID 16724428
1-but-2-ynoxybuta-2,3-dien-2-ylsulfonylbenzene (PubChem CID 16724428) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-but-2-ynoxybuta-2,3-dien-2-ylsulfonylbenzene.
| Compound Name | 1-but-2-ynoxybuta-2,3-dien-2-ylsulfonylbenzene |
|---|---|
| PubChem CID | 16724428 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-but-2-ynoxybuta-2,3-dien-2-ylsulfonylbenzene |
| SMILES | C=C=C(COCC#CC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14O3S/c1-3-5-11-17-12-13(4-2)18(15,16)14-9-7-6-8-10-14/h6-10H,2,11-12H2,1H3 |
| InChIKey | WOCJAKGTHKNXOA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|