C21H23NO4S2 — CID 102175793
N-[2-(benzenesulfonyl)buta-2,3-dienyl]-4-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide (PubChem CID 102175793) has the molecular formula C21H23NO4S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)buta-2,3-dienyl]-4-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide.
| Compound Name | N-[2-(benzenesulfonyl)buta-2,3-dienyl]-4-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102175793 |
| Molecular Formula | C21H23NO4S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[2-(benzenesulfonyl)buta-2,3-dienyl]-4-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide |
| SMILES | C=C=C(CN(CC(=C)C)S(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23NO4S2/c1-5-19(27(23,24)20-9-7-6-8-10-20)16-22(15-17(2)3)28(25,26)21-13-11-18(4)12-14-21/h6-14H,1-2,15-16H2,3-4H3 |
| InChIKey | QPEICMQTMPNKMR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|