C37H45NO2S — CID 101247148
4-methyl-N,N-bis[2-(4-phenylcyclohexyl)prop-2-enyl]benzenesulfonamide (PubChem CID 101247148) has the molecular formula C37H45NO2S and a molecular weight of 567.84 g/mol. Its IUPAC name is 4-methyl-N,N-bis[2-(4-phenylcyclohexyl)prop-2-enyl]benzenesulfonamide.
| Compound Name | 4-methyl-N,N-bis[2-(4-phenylcyclohexyl)prop-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101247148 |
| Molecular Formula | C37H45NO2S |
| Molecular Weight | 567.84 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | 4-methyl-N,N-bis[2-(4-phenylcyclohexyl)prop-2-enyl]benzenesulfonamide |
| SMILES | C=C(CN(CC(=C)C1CCC(c2ccccc2)CC1)S(=O)(=O)c1ccc(C)cc1)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C37H45NO2S/c1-28-14-24-37(25-15-28)41(39,40)38(26-29(2)31-16-20-35(21-17-31)33-10-6-4-7-11-33)27-30(3)32-18-22-36(23-19-32)34-12-8-5-9-13-34/h4-15,24-25,31-32,35-36H,2-3,16-23,26-27H2,1H3 |
| InChIKey | GYVLIVUCCOPPQC-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.84 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|