C17H18O2S — CID 102283005
1-cyclopropylocta-1,2-dien-7-yn-3-ylsulfonylbenzene (PubChem CID 102283005) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-cyclopropylocta-1,2-dien-7-yn-3-ylsulfonylbenzene.
| Compound Name | 1-cyclopropylocta-1,2-dien-7-yn-3-ylsulfonylbenzene |
|---|---|
| PubChem CID | 102283005 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-cyclopropylocta-1,2-dien-7-yn-3-ylsulfonylbenzene |
| SMILES | C#CCCCC(=C=CC1CC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18O2S/c1-2-3-5-8-17(14-13-15-11-12-15)20(18,19)16-9-6-4-7-10-16/h1,4,6-7,9-10,13,15H,3,5,8,11-12H2 |
| InChIKey | FAEYIGPJIWODLP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|