About hept-6-yn-2-one;methane;toluene
hept-6-yn-2-one;methane;toluene (PubChem CID 159521930) has the molecular formula C30H42O
and a molecular weight of 418.67 g/mol. Its IUPAC name is hept-6-yn-2-one;methane;toluene.
Molecular Properties
| Compound Name | hept-6-yn-2-one;methane;toluene |
| PubChem CID | 159521930 |
| Molecular Formula | C30H42O |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.32 |
| IUPAC Name | hept-6-yn-2-one;methane;toluene |
| SMILES | C.C.C#CCCCC(C)=O.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C7H10O.3C7H8.2CH4/c1-3-4-5-6-7(2)8;3*1-7-5-3-2-4-6-7;;/h1H,4-6H2,2H3;3*2-6H,1H3;2*1H4 |
| InChIKey | MBXIGJTZUIGQPH-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hept-6-yn-2-one;methane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-yn-2-one;methane;toluene?
The IUPAC name of hept-6-yn-2-one;methane;toluene (CID 159521930) is hept-6-yn-2-one;methane;toluene.
What is the SMILES notation for hept-6-yn-2-one;methane;toluene?
The canonical SMILES for hept-6-yn-2-one;methane;toluene is C.C.C#CCCCC(C)=O.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1.
What is the InChIKey of hept-6-yn-2-one;methane;toluene?
The InChIKey is MBXIGJTZUIGQPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.3C7H8.2CH4/c1-3-4-5-6-7(2)8;3*1-7-5-3-2-4-6-7;;/h1H,4-6H2,2H3;3*2-6H,1H3;2*1H4.
What are the key properties of hept-6-yn-2-one;methane;toluene?
hept-6-yn-2-one;methane;toluene has a molecular weight of 418.67 g/mol, XLogP of 8.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-yn-2-one;methane;toluene is sourced from PubChem (CID 159521930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).