About trideca-6,12-diyn-2-one
trideca-6,12-diyn-2-one (PubChem CID 14736662) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is trideca-6,12-diyn-2-one.
Molecular Properties
| Compound Name | trideca-6,12-diyn-2-one |
| PubChem CID | 14736662 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | trideca-6,12-diyn-2-one |
| SMILES | C#CCCCCC#CCCCC(C)=O |
| InChI | InChI=1S/C13H18O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h1H,4-7,10-12H2,2H3 |
| InChIKey | OUXWDHNPLDBUGH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trideca-6,12-diyn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trideca-6,12-diyn-2-one?
The IUPAC name of trideca-6,12-diyn-2-one (CID 14736662) is trideca-6,12-diyn-2-one.
What is the SMILES notation for trideca-6,12-diyn-2-one?
The canonical SMILES for trideca-6,12-diyn-2-one is C#CCCCCC#CCCCC(C)=O.
What is the InChIKey of trideca-6,12-diyn-2-one?
The InChIKey is OUXWDHNPLDBUGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h1H,4-7,10-12H2,2H3.
What are the key properties of trideca-6,12-diyn-2-one?
trideca-6,12-diyn-2-one has a molecular weight of 190.29 g/mol, XLogP of 2.94, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trideca-6,12-diyn-2-one is sourced from PubChem (CID 14736662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).