About 9-methyldec-7-yn-2-one
9-methyldec-7-yn-2-one (PubChem CID 133056852) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 9-methyldec-7-yn-2-one.
Molecular Properties
| Compound Name | 9-methyldec-7-yn-2-one |
| PubChem CID | 133056852 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 9-methyldec-7-yn-2-one |
| SMILES | CC(=O)CCCCC#CC(C)C |
| InChI | InChI=1S/C11H18O/c1-10(2)8-6-4-5-7-9-11(3)12/h10H,4-5,7,9H2,1-3H3 |
| InChIKey | CDZLGVPYHNMAKJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-methyldec-7-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyldec-7-yn-2-one?
The IUPAC name of 9-methyldec-7-yn-2-one (CID 133056852) is 9-methyldec-7-yn-2-one.
What is the SMILES notation for 9-methyldec-7-yn-2-one?
The canonical SMILES for 9-methyldec-7-yn-2-one is CC(=O)CCCCC#CC(C)C.
What is the InChIKey of 9-methyldec-7-yn-2-one?
The InChIKey is CDZLGVPYHNMAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-10(2)8-6-4-5-7-9-11(3)12/h10H,4-5,7,9H2,1-3H3.
What are the key properties of 9-methyldec-7-yn-2-one?
9-methyldec-7-yn-2-one has a molecular weight of 166.26 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyldec-7-yn-2-one is sourced from PubChem (CID 133056852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).