About 14-oxopentadec-10-ynoic acid
14-oxopentadec-10-ynoic acid (PubChem CID 21432369) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 14-oxopentadec-10-ynoic acid.
Molecular Properties
| Compound Name | 14-oxopentadec-10-ynoic acid |
| PubChem CID | 21432369 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 14-oxopentadec-10-ynoic acid |
| SMILES | CC(=O)CCC#CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H24O3/c1-14(16)12-10-8-6-4-2-3-5-7-9-11-13-15(17)18/h2-5,7,9-13H2,1H3,(H,17,18) |
| InChIKey | USOFEGPPMASUDJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 14-oxopentadec-10-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-oxopentadec-10-ynoic acid?
The IUPAC name of 14-oxopentadec-10-ynoic acid (CID 21432369) is 14-oxopentadec-10-ynoic acid.
What is the SMILES notation for 14-oxopentadec-10-ynoic acid?
The canonical SMILES for 14-oxopentadec-10-ynoic acid is CC(=O)CCC#CCCCCCCCCC(=O)O.
What is the InChIKey of 14-oxopentadec-10-ynoic acid?
The InChIKey is USOFEGPPMASUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-14(16)12-10-8-6-4-2-3-5-7-9-11-13-15(17)18/h2-5,7,9-13H2,1H3,(H,17,18).
What are the key properties of 14-oxopentadec-10-ynoic acid?
14-oxopentadec-10-ynoic acid has a molecular weight of 252.35 g/mol, XLogP of 3.56, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14-oxopentadec-10-ynoic acid is sourced from PubChem (CID 21432369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).