About octadeca-4,16-diynoic acid
octadeca-4,16-diynoic acid (PubChem CID 169448081) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is octadeca-4,16-diynoic acid.
Molecular Properties
| Compound Name | octadeca-4,16-diynoic acid |
| PubChem CID | 169448081 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | octadeca-4,16-diynoic acid |
| SMILES | CC#CCCCCCCCCCCC#CCCC(=O)O |
| InChI | InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h4-13,16-17H2,1H3,(H,19,20) |
| InChIKey | NINITPMLSOEXFF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze octadeca-4,16-diynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadeca-4,16-diynoic acid?
The IUPAC name of octadeca-4,16-diynoic acid (CID 169448081) is octadeca-4,16-diynoic acid.
What is the SMILES notation for octadeca-4,16-diynoic acid?
The canonical SMILES for octadeca-4,16-diynoic acid is CC#CCCCCCCCCCCC#CCCC(=O)O.
What is the InChIKey of octadeca-4,16-diynoic acid?
The InChIKey is NINITPMLSOEXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h4-13,16-17H2,1H3,(H,19,20).
What are the key properties of octadeca-4,16-diynoic acid?
octadeca-4,16-diynoic acid has a molecular weight of 276.42 g/mol, XLogP of 4.78, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadeca-4,16-diynoic acid is sourced from PubChem (CID 169448081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).