About tetradec-13-ynamide
tetradec-13-ynamide (PubChem CID 19767571) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is tetradec-13-ynamide.
Molecular Properties
| Compound Name | tetradec-13-ynamide |
| PubChem CID | 19767571 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | tetradec-13-ynamide |
| SMILES | C#CCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C14H25NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h1H,3-13H2,(H2,15,16) |
| InChIKey | HIBJSTGPVRTURE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tetradec-13-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradec-13-ynamide?
The IUPAC name of tetradec-13-ynamide (CID 19767571) is tetradec-13-ynamide.
What is the SMILES notation for tetradec-13-ynamide?
The canonical SMILES for tetradec-13-ynamide is C#CCCCCCCCCCCCC(N)=O.
What is the InChIKey of tetradec-13-ynamide?
The InChIKey is HIBJSTGPVRTURE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h1H,3-13H2,(H2,15,16).
What are the key properties of tetradec-13-ynamide?
tetradec-13-ynamide has a molecular weight of 223.36 g/mol, XLogP of 3.40, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetradec-13-ynamide is sourced from PubChem (CID 19767571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).