About undec-10-ynoyl chloride
undec-10-ynoyl chloride (PubChem CID 15389915) has the molecular formula C11H17ClO
and a molecular weight of 200.71 g/mol. Its IUPAC name is undec-10-ynoyl chloride.
Molecular Properties
| Compound Name | undec-10-ynoyl chloride |
| PubChem CID | 15389915 |
| Molecular Formula | C11H17ClO |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | undec-10-ynoyl chloride |
| SMILES | C#CCCCCCCCCC(=O)Cl |
| InChI | InChI=1S/C11H17ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2 |
| InChIKey | XKDNIPKFDFGOGE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze undec-10-ynoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undec-10-ynoyl chloride?
The IUPAC name of undec-10-ynoyl chloride (CID 15389915) is undec-10-ynoyl chloride.
What is the SMILES notation for undec-10-ynoyl chloride?
The canonical SMILES for undec-10-ynoyl chloride is C#CCCCCCCCCC(=O)Cl.
What is the InChIKey of undec-10-ynoyl chloride?
The InChIKey is XKDNIPKFDFGOGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2.
What are the key properties of undec-10-ynoyl chloride?
undec-10-ynoyl chloride has a molecular weight of 200.71 g/mol, XLogP of 3.51, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undec-10-ynoyl chloride is sourced from PubChem (CID 15389915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).