undec-10-ynoyl chloride

C11H17ClO — CID 15389915

IUPACundec-10-ynoyl chloride
SMILESC#CCCCCCCCCC(=O)Cl
InChIInChI=1S/C11H17ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2
InChIKeyXKDNIPKFDFGOGE-UHFFFAOYSA-N
MW200.71 g/mol
LogP3.51
Rot. Bonds8

About undec-10-ynoyl chloride

undec-10-ynoyl chloride (PubChem CID 15389915) has the molecular formula C11H17ClO and a molecular weight of 200.71 g/mol. Its IUPAC name is undec-10-ynoyl chloride.

Molecular Properties

Compound Nameundec-10-ynoyl chloride
PubChem CID15389915
Molecular FormulaC11H17ClO
Molecular Weight200.71 g/mol
Exact Mass200.10
IUPAC Nameundec-10-ynoyl chloride
SMILESC#CCCCCCCCCC(=O)Cl
InChIInChI=1S/C11H17ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2
InChIKeyXKDNIPKFDFGOGE-UHFFFAOYSA-N
XLogP3.51
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.71
LogP ≤ 53.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze undec-10-ynoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of undec-10-ynoyl chloride?
The IUPAC name of undec-10-ynoyl chloride (CID 15389915) is undec-10-ynoyl chloride.
What is the SMILES notation for undec-10-ynoyl chloride?
The canonical SMILES for undec-10-ynoyl chloride is C#CCCCCCCCCC(=O)Cl.
What is the InChIKey of undec-10-ynoyl chloride?
The InChIKey is XKDNIPKFDFGOGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2.
What are the key properties of undec-10-ynoyl chloride?
undec-10-ynoyl chloride has a molecular weight of 200.71 g/mol, XLogP of 3.51, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undec-10-ynoyl chloride is sourced from PubChem (CID 15389915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).