About hexane-1,6-diol;hexanedioyl dichloride
hexane-1,6-diol;hexanedioyl dichloride (PubChem CID 86756475) has the molecular formula C12H22Cl2O4
and a molecular weight of 301.21 g/mol. Its IUPAC name is hexane-1,6-diol;hexanedioyl dichloride.
Molecular Properties
| Compound Name | hexane-1,6-diol;hexanedioyl dichloride |
| PubChem CID | 86756475 |
| Molecular Formula | C12H22Cl2O4 |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | hexane-1,6-diol;hexanedioyl dichloride |
| SMILES | O=C(Cl)CCCCC(=O)Cl.OCCCCCCO |
| InChI | InChI=1S/C6H8Cl2O2.C6H14O2/c7-5(9)3-1-2-4-6(8)10;7-5-3-1-2-4-6-8/h1-4H2;7-8H,1-6H2 |
| InChIKey | JQWUYGOOXSOHPQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane-1,6-diol;hexanedioyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,6-diol;hexanedioyl dichloride?
The IUPAC name of hexane-1,6-diol;hexanedioyl dichloride (CID 86756475) is hexane-1,6-diol;hexanedioyl dichloride.
What is the SMILES notation for hexane-1,6-diol;hexanedioyl dichloride?
The canonical SMILES for hexane-1,6-diol;hexanedioyl dichloride is O=C(Cl)CCCCC(=O)Cl.OCCCCCCO.
What is the InChIKey of hexane-1,6-diol;hexanedioyl dichloride?
The InChIKey is JQWUYGOOXSOHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2O2.C6H14O2/c7-5(9)3-1-2-4-6(8)10;7-5-3-1-2-4-6-8/h1-4H2;7-8H,1-6H2.
What are the key properties of hexane-1,6-diol;hexanedioyl dichloride?
hexane-1,6-diol;hexanedioyl dichloride has a molecular weight of 301.21 g/mol, XLogP of 2.61, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,6-diol;hexanedioyl dichloride is sourced from PubChem (CID 86756475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).