About N-hydroxyhept-6-ynamide
N-hydroxyhept-6-ynamide (PubChem CID 71623064) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is N-hydroxyhept-6-ynamide.
Molecular Properties
| Compound Name | N-hydroxyhept-6-ynamide |
| PubChem CID | 71623064 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | N-hydroxyhept-6-ynamide |
| SMILES | C#CCCCCC(=O)NO |
| InChI | InChI=1S/C7H11NO2/c1-2-3-4-5-6-7(9)8-10/h1,10H,3-6H2,(H,8,9) |
| InChIKey | QFSGWVKCTYUGNH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxyhept-6-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxyhept-6-ynamide?
The IUPAC name of N-hydroxyhept-6-ynamide (CID 71623064) is N-hydroxyhept-6-ynamide.
What is the SMILES notation for N-hydroxyhept-6-ynamide?
The canonical SMILES for N-hydroxyhept-6-ynamide is C#CCCCCC(=O)NO.
What is the InChIKey of N-hydroxyhept-6-ynamide?
The InChIKey is QFSGWVKCTYUGNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-3-4-5-6-7(9)8-10/h1,10H,3-6H2,(H,8,9).
What are the key properties of N-hydroxyhept-6-ynamide?
N-hydroxyhept-6-ynamide has a molecular weight of 141.17 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxyhept-6-ynamide is sourced from PubChem (CID 71623064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).