About heptadec-16-ynoic acid
heptadec-16-ynoic acid (PubChem CID 5312626) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is heptadec-16-ynoic acid.
Molecular Properties
| Compound Name | heptadec-16-ynoic acid |
| PubChem CID | 5312626 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | heptadec-16-ynoic acid |
| SMILES | C#CCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h1H,3-16H2,(H,18,19) |
| InChIKey | RNSFDLGSPZXGGP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze heptadec-16-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadec-16-ynoic acid?
The IUPAC name of heptadec-16-ynoic acid (CID 5312626) is heptadec-16-ynoic acid.
What is the SMILES notation for heptadec-16-ynoic acid?
The canonical SMILES for heptadec-16-ynoic acid is C#CCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of heptadec-16-ynoic acid?
The InChIKey is RNSFDLGSPZXGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h1H,3-16H2,(H,18,19).
What are the key properties of heptadec-16-ynoic acid?
heptadec-16-ynoic acid has a molecular weight of 266.42 g/mol, XLogP of 5.17, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptadec-16-ynoic acid is sourced from PubChem (CID 5312626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).