About deca-7,9-diynoic acid
deca-7,9-diynoic acid (PubChem CID 23238817) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is deca-7,9-diynoic acid.
Molecular Properties
| Compound Name | deca-7,9-diynoic acid |
| PubChem CID | 23238817 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | deca-7,9-diynoic acid |
| SMILES | C#CC#CCCCCCC(=O)O |
| InChI | InChI=1S/C10H12O2/c1-2-3-4-5-6-7-8-9-10(11)12/h1H,5-9H2,(H,11,12) |
| InChIKey | PTYCUPDEYOZEEV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze deca-7,9-diynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deca-7,9-diynoic acid?
The IUPAC name of deca-7,9-diynoic acid (CID 23238817) is deca-7,9-diynoic acid.
What is the SMILES notation for deca-7,9-diynoic acid?
The canonical SMILES for deca-7,9-diynoic acid is C#CC#CCCCCCC(=O)O.
What is the InChIKey of deca-7,9-diynoic acid?
The InChIKey is PTYCUPDEYOZEEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-2-3-4-5-6-7-8-9-10(11)12/h1H,5-9H2,(H,11,12).
What are the key properties of deca-7,9-diynoic acid?
deca-7,9-diynoic acid has a molecular weight of 164.20 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for deca-7,9-diynoic acid is sourced from PubChem (CID 23238817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).