C9H16N2O — CID 163368546
N',N'-dimethylhept-6-ynehydrazide (PubChem CID 163368546) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N',N'-dimethylhept-6-ynehydrazide.
| Compound Name | N',N'-dimethylhept-6-ynehydrazide |
|---|---|
| PubChem CID | 163368546 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N',N'-dimethylhept-6-ynehydrazide |
| SMILES | C#CCCCCC(=O)NN(C)C |
| InChI | InChI=1S/C9H16N2O/c1-4-5-6-7-8-9(12)10-11(2)3/h1H,5-8H2,2-3H3,(H,10,12) |
| InChIKey | PWMZAOJIMQIQBB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|