About 10-cyanodecanamide
10-cyanodecanamide (PubChem CID 87916786) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 10-cyanodecanamide.
Molecular Properties
| Compound Name | 10-cyanodecanamide |
| PubChem CID | 87916786 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 10-cyanodecanamide |
| SMILES | N#CCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C11H20N2O/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1-9H2,(H2,13,14) |
| InChIKey | NSKJUJDUVDQTOB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-cyanodecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-cyanodecanamide?
The IUPAC name of 10-cyanodecanamide (CID 87916786) is 10-cyanodecanamide.
What is the SMILES notation for 10-cyanodecanamide?
The canonical SMILES for 10-cyanodecanamide is N#CCCCCCCCCCC(N)=O.
What is the InChIKey of 10-cyanodecanamide?
The InChIKey is NSKJUJDUVDQTOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1-9H2,(H2,13,14).
What are the key properties of 10-cyanodecanamide?
10-cyanodecanamide has a molecular weight of 196.29 g/mol, XLogP of 2.51, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-cyanodecanamide is sourced from PubChem (CID 87916786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).