About 4-cyanobutyl 5-cyanopentanoate
4-cyanobutyl 5-cyanopentanoate (PubChem CID 88549953) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-cyanobutyl 5-cyanopentanoate.
Molecular Properties
| Compound Name | 4-cyanobutyl 5-cyanopentanoate |
| PubChem CID | 88549953 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 4-cyanobutyl 5-cyanopentanoate |
| SMILES | N#CCCCCOC(=O)CCCCC#N |
| InChI | InChI=1S/C11H16N2O2/c12-8-4-1-3-7-11(14)15-10-6-2-5-9-13/h1-7,10H2 |
| InChIKey | AUEAHIYHHIMLNX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyanobutyl 5-cyanopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanobutyl 5-cyanopentanoate?
The IUPAC name of 4-cyanobutyl 5-cyanopentanoate (CID 88549953) is 4-cyanobutyl 5-cyanopentanoate.
What is the SMILES notation for 4-cyanobutyl 5-cyanopentanoate?
The canonical SMILES for 4-cyanobutyl 5-cyanopentanoate is N#CCCCCOC(=O)CCCCC#N.
What is the InChIKey of 4-cyanobutyl 5-cyanopentanoate?
The InChIKey is AUEAHIYHHIMLNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c12-8-4-1-3-7-11(14)15-10-6-2-5-9-13/h1-7,10H2.
What are the key properties of 4-cyanobutyl 5-cyanopentanoate?
4-cyanobutyl 5-cyanopentanoate has a molecular weight of 208.26 g/mol, XLogP of 2.31, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanobutyl 5-cyanopentanoate is sourced from PubChem (CID 88549953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).