About propyl 11-cyanoundecanoate
propyl 11-cyanoundecanoate (PubChem CID 19904855) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is propyl 11-cyanoundecanoate.
Molecular Properties
| Compound Name | propyl 11-cyanoundecanoate |
| PubChem CID | 19904855 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | propyl 11-cyanoundecanoate |
| SMILES | CCCOC(=O)CCCCCCCCCCC#N |
| InChI | InChI=1S/C15H27NO2/c1-2-14-18-15(17)12-10-8-6-4-3-5-7-9-11-13-16/h2-12,14H2,1H3 |
| InChIKey | QOBMYOXEAPIEFV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propyl 11-cyanoundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 11-cyanoundecanoate?
The IUPAC name of propyl 11-cyanoundecanoate (CID 19904855) is propyl 11-cyanoundecanoate.
What is the SMILES notation for propyl 11-cyanoundecanoate?
The canonical SMILES for propyl 11-cyanoundecanoate is CCCOC(=O)CCCCCCCCCCC#N.
What is the InChIKey of propyl 11-cyanoundecanoate?
The InChIKey is QOBMYOXEAPIEFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-2-14-18-15(17)12-10-8-6-4-3-5-7-9-11-13-16/h2-12,14H2,1H3.
What are the key properties of propyl 11-cyanoundecanoate?
propyl 11-cyanoundecanoate has a molecular weight of 253.39 g/mol, XLogP of 4.36, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 11-cyanoundecanoate is sourced from PubChem (CID 19904855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).