About propyl 12-cyanododecanoate
propyl 12-cyanododecanoate (PubChem CID 19904856) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is propyl 12-cyanododecanoate.
Molecular Properties
| Compound Name | propyl 12-cyanododecanoate |
| PubChem CID | 19904856 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | propyl 12-cyanododecanoate |
| SMILES | CCCOC(=O)CCCCCCCCCCCC#N |
| InChI | InChI=1S/C16H29NO2/c1-2-15-19-16(18)13-11-9-7-5-3-4-6-8-10-12-14-17/h2-13,15H2,1H3 |
| InChIKey | GYHBTPLTBSPJOS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propyl 12-cyanododecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 12-cyanododecanoate?
The IUPAC name of propyl 12-cyanododecanoate (CID 19904856) is propyl 12-cyanododecanoate.
What is the SMILES notation for propyl 12-cyanododecanoate?
The canonical SMILES for propyl 12-cyanododecanoate is CCCOC(=O)CCCCCCCCCCCC#N.
What is the InChIKey of propyl 12-cyanododecanoate?
The InChIKey is GYHBTPLTBSPJOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO2/c1-2-15-19-16(18)13-11-9-7-5-3-4-6-8-10-12-14-17/h2-13,15H2,1H3.
What are the key properties of propyl 12-cyanododecanoate?
propyl 12-cyanododecanoate has a molecular weight of 267.41 g/mol, XLogP of 4.75, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 12-cyanododecanoate is sourced from PubChem (CID 19904856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).