About 3-cyanopropyl hex-5-ynoate
3-cyanopropyl hex-5-ynoate (PubChem CID 88551211) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-cyanopropyl hex-5-ynoate.
Molecular Properties
| Compound Name | 3-cyanopropyl hex-5-ynoate |
| PubChem CID | 88551211 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3-cyanopropyl hex-5-ynoate |
| SMILES | C#CCCCC(=O)OCCCC#N |
| InChI | InChI=1S/C10H13NO2/c1-2-3-4-7-10(12)13-9-6-5-8-11/h1H,3-7,9H2 |
| InChIKey | MUPBDNYTRDUBHY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyanopropyl hex-5-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyanopropyl hex-5-ynoate?
The IUPAC name of 3-cyanopropyl hex-5-ynoate (CID 88551211) is 3-cyanopropyl hex-5-ynoate.
What is the SMILES notation for 3-cyanopropyl hex-5-ynoate?
The canonical SMILES for 3-cyanopropyl hex-5-ynoate is C#CCCCC(=O)OCCCC#N.
What is the InChIKey of 3-cyanopropyl hex-5-ynoate?
The InChIKey is MUPBDNYTRDUBHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-2-3-4-7-10(12)13-9-6-5-8-11/h1H,3-7,9H2.
What are the key properties of 3-cyanopropyl hex-5-ynoate?
3-cyanopropyl hex-5-ynoate has a molecular weight of 179.22 g/mol, XLogP of 1.64, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyanopropyl hex-5-ynoate is sourced from PubChem (CID 88551211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).