About [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate
[3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate (PubChem CID 175842945) has the molecular formula C22H28O6
and a molecular weight of 388.46 g/mol. Its IUPAC name is [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate.
Molecular Properties
| Compound Name | [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate |
| PubChem CID | 175842945 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate |
| SMILES | C#CCCCC(=O)OCC(COC(=O)CCCC#C)COC(=O)CCCC#C |
| InChI | InChI=1S/C22H28O6/c1-4-7-10-13-20(23)26-16-19(17-27-21(24)14-11-8-5-2)18-28-22(25)15-12-9-6-3/h1-3,19H,7-18H2 |
| InChIKey | ONXVJBMBGMCDDQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate?
The IUPAC name of [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate (CID 175842945) is [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate.
What is the SMILES notation for [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate?
The canonical SMILES for [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate is C#CCCCC(=O)OCC(COC(=O)CCCC#C)COC(=O)CCCC#C.
What is the InChIKey of [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate?
The InChIKey is ONXVJBMBGMCDDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O6/c1-4-7-10-13-20(23)26-16-19(17-27-21(24)14-11-8-5-2)18-28-22(25)15-12-9-6-3/h1-3,19H,7-18H2.
What are the key properties of [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate?
[3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate has a molecular weight of 388.46 g/mol, XLogP of 2.64, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hex-5-ynoyloxy-2-(hex-5-ynoyloxymethyl)propyl] hex-5-ynoate is sourced from PubChem (CID 175842945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).