About prop-2-ynyl 4-cyanobutanoate
prop-2-ynyl 4-cyanobutanoate (PubChem CID 88550712) has the molecular formula C8H9NO2
and a molecular weight of 151.17 g/mol. Its IUPAC name is prop-2-ynyl 4-cyanobutanoate.
Molecular Properties
| Compound Name | prop-2-ynyl 4-cyanobutanoate |
| PubChem CID | 88550712 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | prop-2-ynyl 4-cyanobutanoate |
| SMILES | C#CCOC(=O)CCCC#N |
| InChI | InChI=1S/C8H9NO2/c1-2-7-11-8(10)5-3-4-6-9/h1H,3-5,7H2 |
| InChIKey | BNAQUPDFDRACRB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 4-cyanobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 4-cyanobutanoate?
The IUPAC name of prop-2-ynyl 4-cyanobutanoate (CID 88550712) is prop-2-ynyl 4-cyanobutanoate.
What is the SMILES notation for prop-2-ynyl 4-cyanobutanoate?
The canonical SMILES for prop-2-ynyl 4-cyanobutanoate is C#CCOC(=O)CCCC#N.
What is the InChIKey of prop-2-ynyl 4-cyanobutanoate?
The InChIKey is BNAQUPDFDRACRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-2-7-11-8(10)5-3-4-6-9/h1H,3-5,7H2.
What are the key properties of prop-2-ynyl 4-cyanobutanoate?
prop-2-ynyl 4-cyanobutanoate has a molecular weight of 151.17 g/mol, XLogP of 0.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 4-cyanobutanoate is sourced from PubChem (CID 88550712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).