About 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate
4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate (PubChem CID 88616799) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate.
Molecular Properties
| Compound Name | 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate |
| PubChem CID | 88616799 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate |
| SMILES | C#CCOC(=O)CCC(=O)OC(C)(C)C#N |
| InChI | InChI=1S/C11H13NO4/c1-4-7-15-9(13)5-6-10(14)16-11(2,3)8-12/h1H,5-7H2,2-3H3 |
| InChIKey | ZTZJESRNIOREOZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate?
The IUPAC name of 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate (CID 88616799) is 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate.
What is the SMILES notation for 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate?
The canonical SMILES for 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate is C#CCOC(=O)CCC(=O)OC(C)(C)C#N.
What is the InChIKey of 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate?
The InChIKey is ZTZJESRNIOREOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-4-7-15-9(13)5-6-10(14)16-11(2,3)8-12/h1H,5-7H2,2-3H3.
What are the key properties of 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate?
4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate has a molecular weight of 223.23 g/mol, XLogP of 0.79, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-cyanopropan-2-yl) 1-O-prop-2-ynyl butanedioate is sourced from PubChem (CID 88616799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).