About 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate
4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate (PubChem CID 88550662) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate.
Molecular Properties
| Compound Name | 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate |
| PubChem CID | 88550662 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate |
| SMILES | COC(=O)C(C)CC(=O)OC(C)(C)C#N |
| InChI | InChI=1S/C10H15NO4/c1-7(9(13)14-4)5-8(12)15-10(2,3)6-11/h7H,5H2,1-4H3 |
| InChIKey | IQUWKAOGWZNALT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate?
The IUPAC name of 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate (CID 88550662) is 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate.
What is the SMILES notation for 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate?
The canonical SMILES for 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate is COC(=O)C(C)CC(=O)OC(C)(C)C#N.
What is the InChIKey of 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate?
The InChIKey is IQUWKAOGWZNALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4/c1-7(9(13)14-4)5-8(12)15-10(2,3)6-11/h7H,5H2,1-4H3.
What are the key properties of 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate?
4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate has a molecular weight of 213.23 g/mol, XLogP of 1.03, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-cyanopropan-2-yl) 1-O-methyl 2-methylbutanedioate is sourced from PubChem (CID 88550662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).