About 5-methoxy-4-methyl-2,5-dioxopentanoic acid
5-methoxy-4-methyl-2,5-dioxopentanoic acid (PubChem CID 174869002) has the molecular formula C7H10O5
and a molecular weight of 174.15 g/mol. Its IUPAC name is 5-methoxy-4-methyl-2,5-dioxopentanoic acid.
Molecular Properties
| Compound Name | 5-methoxy-4-methyl-2,5-dioxopentanoic acid |
| PubChem CID | 174869002 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 5-methoxy-4-methyl-2,5-dioxopentanoic acid |
| SMILES | COC(=O)C(C)CC(=O)C(=O)O |
| InChI | InChI=1S/C7H10O5/c1-4(7(11)12-2)3-5(8)6(9)10/h4H,3H2,1-2H3,(H,9,10) |
| InChIKey | AQRDVNYJXDPEQR-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-4-methyl-2,5-dioxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4-methyl-2,5-dioxopentanoic acid?
The IUPAC name of 5-methoxy-4-methyl-2,5-dioxopentanoic acid (CID 174869002) is 5-methoxy-4-methyl-2,5-dioxopentanoic acid.
What is the SMILES notation for 5-methoxy-4-methyl-2,5-dioxopentanoic acid?
The canonical SMILES for 5-methoxy-4-methyl-2,5-dioxopentanoic acid is COC(=O)C(C)CC(=O)C(=O)O.
What is the InChIKey of 5-methoxy-4-methyl-2,5-dioxopentanoic acid?
The InChIKey is AQRDVNYJXDPEQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5/c1-4(7(11)12-2)3-5(8)6(9)10/h4H,3H2,1-2H3,(H,9,10).
What are the key properties of 5-methoxy-4-methyl-2,5-dioxopentanoic acid?
5-methoxy-4-methyl-2,5-dioxopentanoic acid has a molecular weight of 174.15 g/mol, XLogP of -0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4-methyl-2,5-dioxopentanoic acid is sourced from PubChem (CID 174869002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).