C17H20O2 — CID 86258648
1-phenylundec-10-yne-1,3-dione (PubChem CID 86258648) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-phenylundec-10-yne-1,3-dione.
| Compound Name | 1-phenylundec-10-yne-1,3-dione |
|---|---|
| PubChem CID | 86258648 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-phenylundec-10-yne-1,3-dione |
| SMILES | C#CCCCCCCC(=O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-2-3-4-5-6-10-13-16(18)14-17(19)15-11-8-7-9-12-15/h1,7-9,11-12H,3-6,10,13-14H2 |
| InChIKey | FBCGGARASDACOQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|