C13H22I2 — CID 90047143
3,13-diiodotrideca-1,2-diene (PubChem CID 90047143) has the molecular formula C13H22I2 and a molecular weight of 432.13 g/mol. Its IUPAC name is 3,13-diiodotrideca-1,2-diene.
| Compound Name | 3,13-diiodotrideca-1,2-diene |
|---|---|
| PubChem CID | 90047143 |
| Molecular Formula | C13H22I2 |
| Molecular Weight | 432.13 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | 3,13-diiodotrideca-1,2-diene |
| SMILES | C=C=C(I)CCCCCCCCCCI |
| InChI | InChI=1S/C13H22I2/c1-2-13(15)11-9-7-5-3-4-6-8-10-12-14/h1,3-12H2 |
| InChIKey | OZOMAAJOBRJMFJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.13 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|