About 6-iodohexanoic acid
6-iodohexanoic acid (PubChem CID 12827948) has the molecular formula C6H11IO2
and a molecular weight of 242.06 g/mol. Its IUPAC name is 6-iodohexanoic acid.
Molecular Properties
| Compound Name | 6-iodohexanoic acid |
| PubChem CID | 12827948 |
| Molecular Formula | C6H11IO2 |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 6-iodohexanoic acid |
| SMILES | O=C(O)CCCCCI |
| InChI | InChI=1S/C6H11IO2/c7-5-3-1-2-4-6(8)9/h1-5H2,(H,8,9) |
| InChIKey | STHOLCAXALUYCX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodohexanoic acid?
The IUPAC name of 6-iodohexanoic acid (CID 12827948) is 6-iodohexanoic acid.
What is the SMILES notation for 6-iodohexanoic acid?
The canonical SMILES for 6-iodohexanoic acid is O=C(O)CCCCCI.
What is the InChIKey of 6-iodohexanoic acid?
The InChIKey is STHOLCAXALUYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11IO2/c7-5-3-1-2-4-6(8)9/h1-5H2,(H,8,9).
What are the key properties of 6-iodohexanoic acid?
6-iodohexanoic acid has a molecular weight of 242.06 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodohexanoic acid is sourced from PubChem (CID 12827948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).