About 14-iodotetradec-7-enoic acid
14-iodotetradec-7-enoic acid (PubChem CID 54286068) has the molecular formula C14H25IO2
and a molecular weight of 352.26 g/mol. Its IUPAC name is 14-iodotetradec-7-enoic acid.
Molecular Properties
| Compound Name | 14-iodotetradec-7-enoic acid |
| PubChem CID | 54286068 |
| Molecular Formula | C14H25IO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 14-iodotetradec-7-enoic acid |
| SMILES | O=C(O)CCCCCC=CCCCCCCI |
| InChI | InChI=1S/C14H25IO2/c15-13-11-9-7-5-3-1-2-4-6-8-10-12-14(16)17/h1-2H,3-13H2,(H,16,17) |
| InChIKey | RUEPZSACMOVGLJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 14-iodotetradec-7-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-iodotetradec-7-enoic acid?
The IUPAC name of 14-iodotetradec-7-enoic acid (CID 54286068) is 14-iodotetradec-7-enoic acid.
What is the SMILES notation for 14-iodotetradec-7-enoic acid?
The canonical SMILES for 14-iodotetradec-7-enoic acid is O=C(O)CCCCCC=CCCCCCCI.
What is the InChIKey of 14-iodotetradec-7-enoic acid?
The InChIKey is RUEPZSACMOVGLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25IO2/c15-13-11-9-7-5-3-1-2-4-6-8-10-12-14(16)17/h1-2H,3-13H2,(H,16,17).
What are the key properties of 14-iodotetradec-7-enoic acid?
14-iodotetradec-7-enoic acid has a molecular weight of 352.26 g/mol, XLogP of 4.96, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 14-iodotetradec-7-enoic acid is sourced from PubChem (CID 54286068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).