About 6-iodohexaneperoxoic acid
6-iodohexaneperoxoic acid (PubChem CID 87969100) has the molecular formula C6H11IO3
and a molecular weight of 258.05 g/mol. Its IUPAC name is 6-iodohexaneperoxoic acid.
Molecular Properties
| Compound Name | 6-iodohexaneperoxoic acid |
| PubChem CID | 87969100 |
| Molecular Formula | C6H11IO3 |
| Molecular Weight | 258.05 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 6-iodohexaneperoxoic acid |
| SMILES | O=C(CCCCCI)OO |
| InChI | InChI=1S/C6H11IO3/c7-5-3-1-2-4-6(8)10-9/h9H,1-5H2 |
| InChIKey | NOWYWGOCRLCIQK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.05 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-iodohexaneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodohexaneperoxoic acid?
The IUPAC name of 6-iodohexaneperoxoic acid (CID 87969100) is 6-iodohexaneperoxoic acid.
What is the SMILES notation for 6-iodohexaneperoxoic acid?
The canonical SMILES for 6-iodohexaneperoxoic acid is O=C(CCCCCI)OO.
What is the InChIKey of 6-iodohexaneperoxoic acid?
The InChIKey is NOWYWGOCRLCIQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11IO3/c7-5-3-1-2-4-6(8)10-9/h9H,1-5H2.
What are the key properties of 6-iodohexaneperoxoic acid?
6-iodohexaneperoxoic acid has a molecular weight of 258.05 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodohexaneperoxoic acid is sourced from PubChem (CID 87969100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).