About ethyl 6-iodohexanoate
ethyl 6-iodohexanoate (PubChem CID 10880140) has the molecular formula C8H15IO2
and a molecular weight of 270.11 g/mol. Its IUPAC name is ethyl 6-iodohexanoate.
Molecular Properties
| Compound Name | ethyl 6-iodohexanoate |
| PubChem CID | 10880140 |
| Molecular Formula | C8H15IO2 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | ethyl 6-iodohexanoate |
| SMILES | CCOC(=O)CCCCCI |
| InChI | InChI=1S/C8H15IO2/c1-2-11-8(10)6-4-3-5-7-9/h2-7H2,1H3 |
| InChIKey | LTWOHZNXCOUWKH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-iodohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-iodohexanoate?
The IUPAC name of ethyl 6-iodohexanoate (CID 10880140) is ethyl 6-iodohexanoate.
What is the SMILES notation for ethyl 6-iodohexanoate?
The canonical SMILES for ethyl 6-iodohexanoate is CCOC(=O)CCCCCI.
What is the InChIKey of ethyl 6-iodohexanoate?
The InChIKey is LTWOHZNXCOUWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15IO2/c1-2-11-8(10)6-4-3-5-7-9/h2-7H2,1H3.
What are the key properties of ethyl 6-iodohexanoate?
ethyl 6-iodohexanoate has a molecular weight of 270.11 g/mol, XLogP of 2.54, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-iodohexanoate is sourced from PubChem (CID 10880140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).