About diethyl decanedioate;propanedioic acid
diethyl decanedioate;propanedioic acid (PubChem CID 174518023) has the molecular formula C17H30O8
and a molecular weight of 362.42 g/mol. Its IUPAC name is diethyl decanedioate;propanedioic acid.
Molecular Properties
| Compound Name | diethyl decanedioate;propanedioic acid |
| PubChem CID | 174518023 |
| Molecular Formula | C17H30O8 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | diethyl decanedioate;propanedioic acid |
| SMILES | CCOC(=O)CCCCCCCCC(=O)OCC.O=C(O)CC(=O)O |
| InChI | InChI=1S/C14H26O4.C3H4O4/c1-3-17-13(15)11-9-7-5-6-8-10-12-14(16)18-4-2;4-2(5)1-3(6)7/h3-12H2,1-2H3;1H2,(H,4,5)(H,6,7) |
| InChIKey | JZPDHCPTAAISKO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl decanedioate;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl decanedioate;propanedioic acid?
The IUPAC name of diethyl decanedioate;propanedioic acid (CID 174518023) is diethyl decanedioate;propanedioic acid.
What is the SMILES notation for diethyl decanedioate;propanedioic acid?
The canonical SMILES for diethyl decanedioate;propanedioic acid is CCOC(=O)CCCCCCCCC(=O)OCC.O=C(O)CC(=O)O.
What is the InChIKey of diethyl decanedioate;propanedioic acid?
The InChIKey is JZPDHCPTAAISKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4.C3H4O4/c1-3-17-13(15)11-9-7-5-6-8-10-12-14(16)18-4-2;4-2(5)1-3(6)7/h3-12H2,1-2H3;1H2,(H,4,5)(H,6,7).
What are the key properties of diethyl decanedioate;propanedioic acid?
diethyl decanedioate;propanedioic acid has a molecular weight of 362.42 g/mol, XLogP of 2.78, 13 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl decanedioate;propanedioic acid is sourced from PubChem (CID 174518023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).