C26H28O10S2 — CID 11758059
trimethyl (1E)-6,7-bis(benzenesulfonyl)octa-1,7-diene-1,4,4-tricarboxylate (PubChem CID 11758059) has the molecular formula C26H28O10S2 and a molecular weight of 564.63 g/mol. Its IUPAC name is trimethyl (1E)-6,7-bis(benzenesulfonyl)octa-1,7-diene-1,4,4-tricarboxylate.
| Compound Name | trimethyl (1E)-6,7-bis(benzenesulfonyl)octa-1,7-diene-1,4,4-tricarboxylate |
|---|---|
| PubChem CID | 11758059 |
| Molecular Formula | C26H28O10S2 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | trimethyl (1E)-6,7-bis(benzenesulfonyl)octa-1,7-diene-1,4,4-tricarboxylate |
| SMILES | C=C(C(CC(C/C=C/C(=O)OC)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H28O10S2/c1-19(37(30,31)20-12-7-5-8-13-20)22(38(32,33)21-14-9-6-10-15-21)18-26(24(28)35-3,25(29)36-4)17-11-16-23(27)34-2/h5-16,22H,1,17-18H2,2-4H3/b16-11+ |
| InChIKey | SQUZMIBHVOPHPM-LFIBNONCSA-N |
| XLogP | 2.66 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|