C16H18O5 — CID 132551860
dimethyl (2E,4E)-7-hydroxy-7-phenylocta-2,4-dienedioate (PubChem CID 132551860) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is dimethyl (2E,4E)-7-hydroxy-7-phenylocta-2,4-dienedioate.
| Compound Name | dimethyl (2E,4E)-7-hydroxy-7-phenylocta-2,4-dienedioate |
|---|---|
| PubChem CID | 132551860 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | dimethyl (2E,4E)-7-hydroxy-7-phenylocta-2,4-dienedioate |
| SMILES | COC(=O)/C=C/C=C/CC(O)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C16H18O5/c1-20-14(17)11-7-4-8-12-16(19,15(18)21-2)13-9-5-3-6-10-13/h3-11,19H,12H2,1-2H3/b8-4+,11-7+ |
| InChIKey | CXBMFCMMBXBICP-RIALUSDFSA-N |
| XLogP | 1.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|