C17H19NO3S — CID 102513497
methyl (2Z,4Z,6Z)-6-(dimethylcarbamoylsulfanyl)-7-phenylhepta-2,4,6-trienoate (PubChem CID 102513497) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is methyl (2Z,4Z,6Z)-6-(dimethylcarbamoylsulfanyl)-7-phenylhepta-2,4,6-trienoate.
| Compound Name | methyl (2Z,4Z,6Z)-6-(dimethylcarbamoylsulfanyl)-7-phenylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 102513497 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | methyl (2Z,4Z,6Z)-6-(dimethylcarbamoylsulfanyl)-7-phenylhepta-2,4,6-trienoate |
| SMILES | COC(=O)/C=C\C=C/C(=C/c1ccccc1)SC(=O)N(C)C |
| InChI | InChI=1S/C17H19NO3S/c1-18(2)17(20)22-15(11-7-8-12-16(19)21-3)13-14-9-5-4-6-10-14/h4-13H,1-3H3/b11-7-,12-8-,15-13- |
| InChIKey | ZUACSQPEEDILKY-DPLLJXJKSA-N |
| XLogP | 3.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|