C21H22O2 — CID 88841794
cyclopropane;methyl 5-(4-phenylphenyl)penta-2,4-dienoate (PubChem CID 88841794) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is cyclopropane;methyl 5-(4-phenylphenyl)penta-2,4-dienoate.
| Compound Name | cyclopropane;methyl 5-(4-phenylphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 88841794 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | cyclopropane;methyl 5-(4-phenylphenyl)penta-2,4-dienoate |
| SMILES | C1CC1.COC(=O)C=CC=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16O2.C3H6/c1-20-18(19)10-6-5-7-15-11-13-17(14-12-15)16-8-3-2-4-9-16;1-2-3-1/h2-14H,1H3;1-3H2 |
| InChIKey | VYCKLTNLCVRZDW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|