C19H24O2Si — CID 177492628
methyl (2E,4E,6E,8E)-9-phenyl-6-trimethylsilylnona-2,4,6,8-tetraenoate (PubChem CID 177492628) has the molecular formula C19H24O2Si and a molecular weight of 312.49 g/mol. Its IUPAC name is methyl (2E,4E,6E,8E)-9-phenyl-6-trimethylsilylnona-2,4,6,8-tetraenoate.
| Compound Name | methyl (2E,4E,6E,8E)-9-phenyl-6-trimethylsilylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 177492628 |
| Molecular Formula | C19H24O2Si |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | methyl (2E,4E,6E,8E)-9-phenyl-6-trimethylsilylnona-2,4,6,8-tetraenoate |
| SMILES | COC(=O)/C=C/C=C/C(=C\C=C\c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C19H24O2Si/c1-21-19(20)16-9-8-14-18(22(2,3)4)15-10-13-17-11-6-5-7-12-17/h5-16H,1-4H3/b13-10+,14-8+,16-9+,18-15+ |
| InChIKey | ZFVBRUJQSHTLED-BWMIGYOZSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|