C13H14O2 — CID 101120530
(3Z,5E)-3-methoxy-6-phenylhexa-3,5-dien-2-one (PubChem CID 101120530) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (3Z,5E)-3-methoxy-6-phenylhexa-3,5-dien-2-one.
| Compound Name | (3Z,5E)-3-methoxy-6-phenylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 101120530 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (3Z,5E)-3-methoxy-6-phenylhexa-3,5-dien-2-one |
| SMILES | CO/C(=C\C=C\c1ccccc1)C(C)=O |
| InChI | InChI=1S/C13H14O2/c1-11(14)13(15-2)10-6-9-12-7-4-3-5-8-12/h3-10H,1-2H3/b9-6+,13-10- |
| InChIKey | MHLOQYVNJYGSKN-AWTKBBGNSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|