C26H30O6 — CID 173388438
ethane-1,2-diol;bis(2-methyl-5-phenylpenta-2,4-dienoic acid) (PubChem CID 173388438) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is ethane-1,2-diol;bis(2-methyl-5-phenylpenta-2,4-dienoic acid).
| Compound Name | ethane-1,2-diol;bis(2-methyl-5-phenylpenta-2,4-dienoic acid) |
|---|---|
| PubChem CID | 173388438 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | ethane-1,2-diol;bis(2-methyl-5-phenylpenta-2,4-dienoic acid) |
| SMILES | CC(=CC=Cc1ccccc1)C(=O)O.CC(=CC=Cc1ccccc1)C(=O)O.OCCO |
| InChI | InChI=1S/2C12H12O2.C2H6O2/c2*1-10(12(13)14)6-5-9-11-7-3-2-4-8-11;3-1-2-4/h2*2-9H,1H3,(H,13,14);3-4H,1-2H2 |
| InChIKey | IKFKXGKVCUGHNR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|