C11H10O2S — CID 965917
5-phenyl-2-sulfanylpenta-2,4-dienoic acid (PubChem CID 965917) has the molecular formula C11H10O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is 5-phenyl-2-sulfanylpenta-2,4-dienoic acid.
| Compound Name | 5-phenyl-2-sulfanylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 965917 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 5-phenyl-2-sulfanylpenta-2,4-dienoic acid |
| SMILES | O=C(O)C(S)=CC=Cc1ccccc1 |
| InChI | InChI=1S/C11H10O2S/c12-11(13)10(14)8-4-7-9-5-2-1-3-6-9/h1-8,14H,(H,12,13) |
| InChIKey | JOPSFFUFGFILRK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|